C37H34N2O4 — CID 10721772
2-[cyclohexyl-[3-phenyl-4-(quinolin-2-ylmethoxy)phenyl]methoxy]-4,5-dihydroisoindole-1,3-dione (PubChem CID 10721772) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is 2-[cyclohexyl-[3-phenyl-4-(quinolin-2-ylmethoxy)phenyl]methoxy]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | 2-[cyclohexyl-[3-phenyl-4-(quinolin-2-ylmethoxy)phenyl]methoxy]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 10721772 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 2-[cyclohexyl-[3-phenyl-4-(quinolin-2-ylmethoxy)phenyl]methoxy]-4,5-dihydroisoindole-1,3-dione |
| SMILES | O=C1C2=C(CCC=C2)C(=O)N1OC(c1ccc(OCc2ccc3ccccc3n2)c(-c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C37H34N2O4/c40-36-30-16-8-9-17-31(30)37(41)39(36)43-35(27-14-5-2-6-15-27)28-20-22-34(32(23-28)25-11-3-1-4-12-25)42-24-29-21-19-26-13-7-10-18-33(26)38-29/h1,3-4,7-8,10-13,16,18-23,27,35H,2,5-6,9,14-15,17,24H2 |
| InChIKey | XAJROHTWNGUDPJ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|