C33H32N2O4 — CID 139896166
2-[1-[3-cyclohexyl-4-(quinolin-2-ylmethoxy)phenyl]propoxy]isoindole-1,3-dione (PubChem CID 139896166) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-[1-[3-cyclohexyl-4-(quinolin-2-ylmethoxy)phenyl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-cyclohexyl-4-(quinolin-2-ylmethoxy)phenyl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139896166 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[1-[3-cyclohexyl-4-(quinolin-2-ylmethoxy)phenyl]propoxy]isoindole-1,3-dione |
| SMILES | CCC(ON1C(=O)c2ccccc2C1=O)c1ccc(OCc2ccc3ccccc3n2)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C33H32N2O4/c1-2-30(39-35-32(36)26-13-7-8-14-27(26)33(35)37)24-17-19-31(28(20-24)22-10-4-3-5-11-22)38-21-25-18-16-23-12-6-9-15-29(23)34-25/h6-9,12-20,22,30H,2-5,10-11,21H2,1H3 |
| InChIKey | OQNGLDDWPHFMBC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|