C34H36N2O4 — CID 11800504
2-[2-butyl-1-[4-(quinolin-2-ylmethoxy)phenyl]hexoxy]isoindole-1,3-dione (PubChem CID 11800504) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[2-butyl-1-[4-(quinolin-2-ylmethoxy)phenyl]hexoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-butyl-1-[4-(quinolin-2-ylmethoxy)phenyl]hexoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11800504 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[2-butyl-1-[4-(quinolin-2-ylmethoxy)phenyl]hexoxy]isoindole-1,3-dione |
| SMILES | CCCCC(CCCC)C(ON1C(=O)c2ccccc2C1=O)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C34H36N2O4/c1-3-5-11-25(12-6-4-2)32(40-36-33(37)29-14-8-9-15-30(29)34(36)38)26-18-21-28(22-19-26)39-23-27-20-17-24-13-7-10-16-31(24)35-27/h7-10,13-22,25,32H,3-6,11-12,23H2,1-2H3 |
| InChIKey | VVCHNJBLSXTTNS-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|