C13H28N4O2 — CID 107223249
N'-hydroxy-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylbutanimidamide (PubChem CID 107223249) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N'-hydroxy-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylbutanimidamide.
| Compound Name | N'-hydroxy-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 107223249 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | N'-hydroxy-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCN1CCCN(CCO)CC1)C(N)=NO |
| InChI | InChI=1S/C13H28N4O2/c1-13(2,12(14)15-19)4-7-16-5-3-6-17(9-8-16)10-11-18/h18-19H,3-11H2,1-2H3,(H2,14,15) |
| InChIKey | OPFXJWUOAJUOAC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|