C16H25N3 — CID 107236430
N'-[(1,3-dimethylindol-2-yl)methyl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 107236430) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N'-[(1,3-dimethylindol-2-yl)methyl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-[(1,3-dimethylindol-2-yl)methyl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107236430 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N'-[(1,3-dimethylindol-2-yl)methyl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)Cc1c(C)c2ccccc2n1C |
| InChI | InChI=1S/C16H25N3/c1-13-14-8-5-6-9-15(14)19(4)16(13)12-18(3)11-7-10-17-2/h5-6,8-9,17H,7,10-12H2,1-4H3 |
| InChIKey | ICQNWGNCUVIROQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|