C17H27ClN2O3 — CID 107255728
tert-butyl N-[4-[(5-chlorofuran-2-yl)methylamino]cyclohexyl]-N-methylcarbamate (PubChem CID 107255728) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-chlorofuran-2-yl)methylamino]cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[(5-chlorofuran-2-yl)methylamino]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 107255728 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tert-butyl N-[4-[(5-chlorofuran-2-yl)methylamino]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCC(NCc2ccc(Cl)o2)CC1 |
| InChI | InChI=1S/C17H27ClN2O3/c1-17(2,3)23-16(21)20(4)13-7-5-12(6-8-13)19-11-14-9-10-15(18)22-14/h9-10,12-13,19H,5-8,11H2,1-4H3 |
| InChIKey | MCZXCODGLHUUGX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |