C14H23ClN2O — CID 54866594
1-tert-butyl-N-[(5-chlorofuran-2-yl)methyl]piperidin-4-amine (PubChem CID 54866594) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-tert-butyl-N-[(5-chlorofuran-2-yl)methyl]piperidin-4-amine.
| Compound Name | 1-tert-butyl-N-[(5-chlorofuran-2-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 54866594 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-tert-butyl-N-[(5-chlorofuran-2-yl)methyl]piperidin-4-amine |
| SMILES | CC(C)(C)N1CCC(NCc2ccc(Cl)o2)CC1 |
| InChI | InChI=1S/C14H23ClN2O/c1-14(2,3)17-8-6-11(7-9-17)16-10-12-4-5-13(15)18-12/h4-5,11,16H,6-10H2,1-3H3 |
| InChIKey | WPQJKRRJFJOFOB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |