C17H19ClN2O3 — CID 166237714
4-[4-[(5-chlorofuran-2-yl)methylamino]piperidin-1-yl]benzoic acid (PubChem CID 166237714) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 4-[4-[(5-chlorofuran-2-yl)methylamino]piperidin-1-yl]benzoic acid.
| Compound Name | 4-[4-[(5-chlorofuran-2-yl)methylamino]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 166237714 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-[4-[(5-chlorofuran-2-yl)methylamino]piperidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC(NCc3ccc(Cl)o3)CC2)cc1 |
| InChI | InChI=1S/C17H19ClN2O3/c18-16-6-5-15(23-16)11-19-13-7-9-20(10-8-13)14-3-1-12(2-4-14)17(21)22/h1-6,13,19H,7-11H2,(H,21,22) |
| InChIKey | XGBGSFLZSYVEGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |