C25H35N3O2 — CID 59683602
tert-butyl N-methyl-N-[4-[(2-methyl-5-pyridin-4-ylphenyl)methylamino]cyclohexyl]carbamate (PubChem CID 59683602) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-[(2-methyl-5-pyridin-4-ylphenyl)methylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-[(2-methyl-5-pyridin-4-ylphenyl)methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59683602 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | tert-butyl N-methyl-N-[4-[(2-methyl-5-pyridin-4-ylphenyl)methylamino]cyclohexyl]carbamate |
| SMILES | Cc1ccc(-c2ccncc2)cc1CNC1CCC(N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H35N3O2/c1-18-6-7-20(19-12-14-26-15-13-19)16-21(18)17-27-22-8-10-23(11-9-22)28(5)24(29)30-25(2,3)4/h6-7,12-16,22-23,27H,8-11,17H2,1-5H3 |
| InChIKey | HRBVRLOFPFAPGK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |