C8H10N4 — CID 10725677
2,8,9-trimethylpurine (PubChem CID 10725677) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,8,9-trimethylpurine.
| Compound Name | 2,8,9-trimethylpurine |
|---|---|
| PubChem CID | 10725677 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,8,9-trimethylpurine |
| SMILES | Cc1ncc2nc(C)n(C)c2n1 |
| InChI | InChI=1S/C8H10N4/c1-5-9-4-7-8(10-5)12(3)6(2)11-7/h4H,1-3H3 |
| InChIKey | BCBYSUAKADTZMV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |