C15H20N2O3S — CID 107265358
N-(4-tert-butylphenyl)-5-(hydroxymethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 107265358) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-(hydroxymethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-tert-butylphenyl)-5-(hydroxymethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 107265358 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-(hydroxymethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(C)(C)c1ccc(NS(=O)(=O)c2c[nH]c(CO)c2)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-15(2,3)11-4-6-12(7-5-11)17-21(19,20)14-8-13(10-18)16-9-14/h4-9,16-18H,10H2,1-3H3 |
| InChIKey | FCZRPPAWQKFUMS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |