C15H21F2NO3 — CID 107270673
3-[[1-[3-(difluoromethoxy)phenyl]ethylamino]methyl]-2-methyloxolan-3-ol (PubChem CID 107270673) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 3-[[1-[3-(difluoromethoxy)phenyl]ethylamino]methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[[1-[3-(difluoromethoxy)phenyl]ethylamino]methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 107270673 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[[1-[3-(difluoromethoxy)phenyl]ethylamino]methyl]-2-methyloxolan-3-ol |
| SMILES | CC(NCC1(O)CCOC1C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2NO3/c1-10(18-9-15(19)6-7-20-11(15)2)12-4-3-5-13(8-12)21-14(16)17/h3-5,8,10-11,14,18-19H,6-7,9H2,1-2H3 |
| InChIKey | QOPFWAYWUKOSBS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |