C12H24N2O — CID 10727286
(2R,3S)-1-amino-2-[bis(prop-2-enyl)amino]hexan-3-ol (PubChem CID 10727286) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (2R,3S)-1-amino-2-[bis(prop-2-enyl)amino]hexan-3-ol.
| Compound Name | (2R,3S)-1-amino-2-[bis(prop-2-enyl)amino]hexan-3-ol |
|---|---|
| PubChem CID | 10727286 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2R,3S)-1-amino-2-[bis(prop-2-enyl)amino]hexan-3-ol |
| SMILES | C=CCN(CC=C)[C@H](CN)[C@@H](O)CCC |
| InChI | InChI=1S/C12H24N2O/c1-4-7-12(15)11(10-13)14(8-5-2)9-6-3/h5-6,11-12,15H,2-4,7-10,13H2,1H3/t11-,12+/m1/s1 |
| InChIKey | DUTAJYAJTUJOJV-NEPJUHHUSA-N |
| XLogP | 1.15 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|