C15H13Br3OS — CID 107294565
5-[bromo-(4,5-dibromothiophen-2-yl)methyl]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294565) has the molecular formula C15H13Br3OS and a molecular weight of 481.05 g/mol. Its IUPAC name is 5-[bromo-(4,5-dibromothiophen-2-yl)methyl]-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-[bromo-(4,5-dibromothiophen-2-yl)methyl]-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294565 |
| Molecular Formula | C15H13Br3OS |
| Molecular Weight | 481.05 g/mol |
| Exact Mass | 477.82 |
| IUPAC Name | 5-[bromo-(4,5-dibromothiophen-2-yl)methyl]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Br)c3cc(Br)c(Br)s3)cc21 |
| InChI | InChI=1S/C15H13Br3OS/c1-15(2)7-19-11-4-3-8(5-9(11)15)13(17)12-6-10(16)14(18)20-12/h3-6,13H,7H2,1-2H3 |
| InChIKey | PYMRIOQJCNJKMO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.05 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|