C14H11Br3S — CID 80534520
2,3-dibromo-5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]thiophene (PubChem CID 80534520) has the molecular formula C14H11Br3S and a molecular weight of 451.02 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]thiophene |
|---|---|
| PubChem CID | 80534520 |
| Molecular Formula | C14H11Br3S |
| Molecular Weight | 451.02 g/mol |
| Exact Mass | 447.81 |
| IUPAC Name | 2,3-dibromo-5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]thiophene |
| SMILES | Brc1cc(C(Br)c2ccc3c(c2)CCC3)sc1Br |
| InChI | InChI=1S/C14H11Br3S/c15-11-7-12(18-14(11)17)13(16)10-5-4-8-2-1-3-9(8)6-10/h4-7,13H,1-3H2 |
| InChIKey | BZQBDKRAWOFJDB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.02 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|