C20H17Br — CID 63440446
2-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]naphthalene (PubChem CID 63440446) has the molecular formula C20H17Br and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]naphthalene.
| Compound Name | 2-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]naphthalene |
|---|---|
| PubChem CID | 63440446 |
| Molecular Formula | C20H17Br |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]naphthalene |
| SMILES | BrC(c1ccc2c(c1)CCC2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17Br/c21-20(19-11-9-15-6-3-7-17(15)13-19)18-10-8-14-4-1-2-5-16(14)12-18/h1-2,4-5,8-13,20H,3,6-7H2 |
| InChIKey | AQMVCHCMZLSLFQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|