C13H16N2O4S — CID 107297476
5-hydroxy-2-(thiolan-3-ylmethylcarbamoylamino)benzoic acid (PubChem CID 107297476) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-hydroxy-2-(thiolan-3-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(thiolan-3-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107297476 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-hydroxy-2-(thiolan-3-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCC1CCSC1)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C13H16N2O4S/c16-9-1-2-11(10(5-9)12(17)18)15-13(19)14-6-8-3-4-20-7-8/h1-2,5,8,16H,3-4,6-7H2,(H,17,18)(H2,14,15,19) |
| InChIKey | UAXQFUPMOYYDDS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|