C12H13Cl2N3O — CID 107309599
2-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]propan-2-ol (PubChem CID 107309599) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]propan-2-ol.
| Compound Name | 2-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 107309599 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-[1-[(2,3-dichlorophenyl)methyl]triazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn(Cc2cccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C12H13Cl2N3O/c1-12(2,18)10-7-17(16-15-10)6-8-4-3-5-9(13)11(8)14/h3-5,7,18H,6H2,1-2H3 |
| InChIKey | IIJQMLKZZWSTOB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |