C7H15F3N2O3S — CID 107319458
5-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol (PubChem CID 107319458) has the molecular formula C7H15F3N2O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol.
| Compound Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
|---|---|
| PubChem CID | 107319458 |
| Molecular Formula | C7H15F3N2O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-1-ol |
| SMILES | O=S(=O)(NCCCCCO)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O3S/c8-7(9,10)6-12-16(14,15)11-4-2-1-3-5-13/h11-13H,1-6H2 |
| InChIKey | DXQASCIGOIJHQA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|