C7H15F3N2O3S — CID 106125965
5-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol (PubChem CID 106125965) has the molecular formula C7H15F3N2O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol.
| Compound Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol |
|---|---|
| PubChem CID | 106125965 |
| Molecular Formula | C7H15F3N2O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol |
| SMILES | CC(O)CCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O3S/c1-6(13)3-2-4-11-16(14,15)12-5-7(8,9)10/h6,11-13H,2-5H2,1H3 |
| InChIKey | SIKZOWBLBCBZMO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|