C17H28O2Si — CID 10732443
2-[(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]ethynyl-trimethylsilane (PubChem CID 10732443) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10732443 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]ethynyl-trimethylsilane |
| SMILES | C=CCC1(CC=C)C[C@@H](C#C[Si](C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C17H28O2Si/c1-8-11-17(12-9-2)14-15(10-13-20(5,6)7)18-16(3,4)19-17/h8-9,15H,1-2,11-12,14H2,3-7H3/t15-/m1/s1 |
| InChIKey | MDRHMZIPRBNHPJ-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|