C22H38O3Si — CID 10762231
tert-butyl-[(3S,4S)-8-(2,2-dimethyl-1,3-dioxan-5-yl)-4-ethenyloct-1-en-7-yn-3-yl]oxy-dimethylsilane (PubChem CID 10762231) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is tert-butyl-[(3S,4S)-8-(2,2-dimethyl-1,3-dioxan-5-yl)-4-ethenyloct-1-en-7-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S)-8-(2,2-dimethyl-1,3-dioxan-5-yl)-4-ethenyloct-1-en-7-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10762231 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl-[(3S,4S)-8-(2,2-dimethyl-1,3-dioxan-5-yl)-4-ethenyloct-1-en-7-yn-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](CCC#CC1COC(C)(C)OC1)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-10-19(20(11-2)25-26(8,9)21(3,4)5)15-13-12-14-18-16-23-22(6,7)24-17-18/h10-11,18-20H,1-2,13,15-17H2,3-9H3/t19-,20+/m1/s1 |
| InChIKey | JBTOGUQZUSSEDN-UXHICEINSA-N |
| XLogP | 5.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|