C13H9BrF3IN2O — CID 107335757
1-N-[3-bromo-4-(trifluoromethoxy)phenyl]-4-iodobenzene-1,2-diamine (PubChem CID 107335757) has the molecular formula C13H9BrF3IN2O and a molecular weight of 473.03 g/mol. Its IUPAC name is 1-N-[3-bromo-4-(trifluoromethoxy)phenyl]-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-[3-bromo-4-(trifluoromethoxy)phenyl]-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 107335757 |
| Molecular Formula | C13H9BrF3IN2O |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 471.89 |
| IUPAC Name | 1-N-[3-bromo-4-(trifluoromethoxy)phenyl]-4-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1Nc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C13H9BrF3IN2O/c14-9-6-8(2-4-12(9)21-13(15,16)17)20-11-3-1-7(18)5-10(11)19/h1-6,20H,19H2 |
| InChIKey | PWDBNZLDABVFME-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|