C16H27NO5 — CID 10733972
methyl (1R,4R,8R,9R)-4-butoxy-5,7-dioxa-6-azatricyclo[7.4.0.01,6]tridecane-8-carboxylate (PubChem CID 10733972) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is methyl (1R,4R,8R,9R)-4-butoxy-5,7-dioxa-6-azatricyclo[7.4.0.01,6]tridecane-8-carboxylate.
| Compound Name | methyl (1R,4R,8R,9R)-4-butoxy-5,7-dioxa-6-azatricyclo[7.4.0.01,6]tridecane-8-carboxylate |
|---|---|
| PubChem CID | 10733972 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | methyl (1R,4R,8R,9R)-4-butoxy-5,7-dioxa-6-azatricyclo[7.4.0.01,6]tridecane-8-carboxylate |
| SMILES | CCCCO[C@H]1CC[C@]23CCCC[C@H]2[C@H](C(=O)OC)ON3O1 |
| InChI | InChI=1S/C16H27NO5/c1-3-4-11-20-13-8-10-16-9-6-5-7-12(16)14(15(18)19-2)22-17(16)21-13/h12-14H,3-11H2,1-2H3/t12-,13+,14+,16+/m0/s1 |
| InChIKey | DVCYSKZAMFBFPB-DSJMHWKBSA-N |
| XLogP | 2.57 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|