C22H27NO4 — CID 15812091
methyl (3R,5R)-2-benzhydryl-5-butoxy-1,2-oxazolidine-3-carboxylate (PubChem CID 15812091) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl (3R,5R)-2-benzhydryl-5-butoxy-1,2-oxazolidine-3-carboxylate.
| Compound Name | methyl (3R,5R)-2-benzhydryl-5-butoxy-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15812091 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | methyl (3R,5R)-2-benzhydryl-5-butoxy-1,2-oxazolidine-3-carboxylate |
| SMILES | CCCCO[C@H]1C[C@H](C(=O)OC)N(C(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C22H27NO4/c1-3-4-15-26-20-16-19(22(24)25-2)23(27-20)21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-21H,3-4,15-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | CSHFPQKCTMJYGR-WOJBJXKFSA-N |
| XLogP | 4.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|