C18H23NO6 — CID 100963005
[(2R,3aR,4S,6S)-6-butoxy-2-formyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate (PubChem CID 100963005) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [(2R,3aR,4S,6S)-6-butoxy-2-formyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate.
| Compound Name | [(2R,3aR,4S,6S)-6-butoxy-2-formyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
|---|---|
| PubChem CID | 100963005 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(2R,3aR,4S,6S)-6-butoxy-2-formyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
| SMILES | CCCCO[C@@H]1C[C@H](OC(=O)c2ccccc2)[C@H]2C[C@H](C=O)ON2O1 |
| InChI | InChI=1S/C18H23NO6/c1-2-3-9-22-17-11-16(15-10-14(12-20)24-19(15)25-17)23-18(21)13-7-5-4-6-8-13/h4-8,12,14-17H,2-3,9-11H2,1H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | BESZPYXIDCWOAA-NCOADZHNSA-N |
| XLogP | 2.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|