C19H28NO6+ — CID 140620652
[(3S,7S,8S,9S)-8-benzoyloxy-7-butoxy-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium (PubChem CID 140620652) has the molecular formula C19H28NO6+ and a molecular weight of 366.43 g/mol. Its IUPAC name is [(3S,7S,8S,9S)-8-benzoyloxy-7-butoxy-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium.
| Compound Name | [(3S,7S,8S,9S)-8-benzoyloxy-7-butoxy-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
|---|---|
| PubChem CID | 140620652 |
| Molecular Formula | C19H28NO6+ |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(3S,7S,8S,9S)-8-benzoyloxy-7-butoxy-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
| SMILES | CCCCO[C@H]1COC[C@H]([NH3+])C(=O)O[C@@H](C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO6/c1-3-4-10-24-16-12-23-11-15(20)19(22)25-13(2)17(16)26-18(21)14-8-6-5-7-9-14/h5-9,13,15-17H,3-4,10-12,20H2,1-2H3/p+1/t13-,15-,16-,17-/m0/s1 |
| InChIKey | BGLOUUYOMTZCBT-HJWJTTGWSA-O |
| XLogP | 0.97 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|