C31H49N3O7 — CID 71023516
[(1R)-3-azido-2-[(5R)-3,4,5-tributoxy-6-methyloxan-2-yl]oxycyclohexyl] benzoate (PubChem CID 71023516) has the molecular formula C31H49N3O7 and a molecular weight of 575.75 g/mol. Its IUPAC name is [(1R)-3-azido-2-[(5R)-3,4,5-tributoxy-6-methyloxan-2-yl]oxycyclohexyl] benzoate.
| Compound Name | [(1R)-3-azido-2-[(5R)-3,4,5-tributoxy-6-methyloxan-2-yl]oxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 71023516 |
| Molecular Formula | C31H49N3O7 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | [(1R)-3-azido-2-[(5R)-3,4,5-tributoxy-6-methyloxan-2-yl]oxycyclohexyl] benzoate |
| SMILES | CCCCOC1C(OC2C(N=[N+]=[N-])CCC[C@H]2OC(=O)c2ccccc2)OC(C)[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C31H49N3O7/c1-5-8-19-36-26-22(4)39-31(29(38-21-10-7-3)28(26)37-20-9-6-2)41-27-24(33-34-32)17-14-18-25(27)40-30(35)23-15-12-11-13-16-23/h11-13,15-16,22,24-29,31H,5-10,14,17-21H2,1-4H3/t22?,24?,25-,26-,27?,28?,29?,31?/m1/s1 |
| InChIKey | UTHBUJODCDNOAX-HRVIKWGPSA-N |
| XLogP | 6.76 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|