C43H67ClN6O15 — CID 121285242
[2-[5-azido-4-butoxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-[3-azido-4,5-dibutoxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-butoxy-6-[(2-chloroacetyl)oxymethyl]oxan-3-yl] benzoate (PubChem CID 121285242) has the molecular formula C43H67ClN6O15 and a molecular weight of 943.49 g/mol. Its IUPAC name is [2-[5-azido-4-butoxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-[3-azido-4,5-dibutoxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-butoxy-6-[(2-chloroacetyl)oxymethyl]oxan-3-yl] benzoate.
| Compound Name | [2-[5-azido-4-butoxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-[3-azido-4,5-dibutoxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-butoxy-6-[(2-chloroacetyl)oxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 121285242 |
| Molecular Formula | C43H67ClN6O15 |
| Molecular Weight | 943.49 g/mol |
| Exact Mass | 942.44 |
| IUPAC Name | [2-[5-azido-4-butoxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-[3-azido-4,5-dibutoxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-butoxy-6-[(2-chloroacetyl)oxymethyl]oxan-3-yl] benzoate |
| SMILES | CCCCOC1C(N=[N+]=[N-])COC(CO)C1OC1OC(COC(=O)CCl)C(OC2OC(CO)C(OCCCC)C(OCCCC)C2N=[N+]=[N-])C(OCCCC)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C43H67ClN6O15/c1-5-9-18-55-34-28(47-49-45)25-59-29(23-51)36(34)65-43-40(63-41(54)27-16-14-13-15-17-27)39(58-21-12-8-4)37(31(62-43)26-60-32(53)22-44)64-42-33(48-50-46)38(57-20-11-7-3)35(30(24-52)61-42)56-19-10-6-2/h13-17,28-31,33-40,42-43,51-52H,5-12,18-26H2,1-4H3 |
| InChIKey | YNWIVTSJTARFTJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 273.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|