C16H31ClNO5+ — CID 140620682
[(3S,7S,8S,9S)-7-butoxy-8-(2-chloro-2-methylpropoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium (PubChem CID 140620682) has the molecular formula C16H31ClNO5+ and a molecular weight of 352.88 g/mol. Its IUPAC name is [(3S,7S,8S,9S)-7-butoxy-8-(2-chloro-2-methylpropoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium.
| Compound Name | [(3S,7S,8S,9S)-7-butoxy-8-(2-chloro-2-methylpropoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
|---|---|
| PubChem CID | 140620682 |
| Molecular Formula | C16H31ClNO5+ |
| Molecular Weight | 352.88 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(3S,7S,8S,9S)-7-butoxy-8-(2-chloro-2-methylpropoxy)-9-methyl-2-oxo-1,5-dioxonan-3-yl]azanium |
| SMILES | CCCCO[C@H]1COC[C@H]([NH3+])C(=O)O[C@@H](C)[C@@H]1OCC(C)(C)Cl |
| InChI | InChI=1S/C16H30ClNO5/c1-5-6-7-21-13-9-20-8-12(18)15(19)23-11(2)14(13)22-10-16(3,4)17/h11-14H,5-10,18H2,1-4H3/p+1/t11-,12-,13-,14-/m0/s1 |
| InChIKey | GKHYNTMBPWYBII-XUXIUFHCSA-O |
| XLogP | 1.15 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.88 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|