C12H20F3NO4 — CID 130198615
(3S,8R,9S)-3-amino-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-2-one (PubChem CID 130198615) has the molecular formula C12H20F3NO4 and a molecular weight of 299.29 g/mol. Its IUPAC name is (3S,8R,9S)-3-amino-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-2-one.
| Compound Name | (3S,8R,9S)-3-amino-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-2-one |
|---|---|
| PubChem CID | 130198615 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3S,8R,9S)-3-amino-9-methyl-8-(4,4,4-trifluorobutoxy)-1,5-dioxonan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)COCC[C@H]1OCCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO4/c1-8-10(19-5-2-4-12(13,14)15)3-6-18-7-9(16)11(17)20-8/h8-10H,2-7,16H2,1H3/t8-,9-,10+/m0/s1 |
| InChIKey | VLULNWUHNMDGLB-LPEHRKFASA-N |
| XLogP | 1.39 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|