C21H31ClF3NO3 — CID 162316815
(3S,7R,8R,9S)-3-amino-9-methyl-7-[(4-methylphenyl)methyl]-8-(4,4,4-trifluorobutoxy)oxonan-2-one;hydrochloride (PubChem CID 162316815) has the molecular formula C21H31ClF3NO3 and a molecular weight of 437.93 g/mol. Its IUPAC name is (3S,7R,8R,9S)-3-amino-9-methyl-7-[(4-methylphenyl)methyl]-8-(4,4,4-trifluorobutoxy)oxonan-2-one;hydrochloride.
| Compound Name | (3S,7R,8R,9S)-3-amino-9-methyl-7-[(4-methylphenyl)methyl]-8-(4,4,4-trifluorobutoxy)oxonan-2-one;hydrochloride |
|---|---|
| PubChem CID | 162316815 |
| Molecular Formula | C21H31ClF3NO3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (3S,7R,8R,9S)-3-amino-9-methyl-7-[(4-methylphenyl)methyl]-8-(4,4,4-trifluorobutoxy)oxonan-2-one;hydrochloride |
| SMILES | Cc1ccc(C[C@H]2CCC[C@H](N)C(=O)O[C@@H](C)[C@@H]2OCCCC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C21H30F3NO3.ClH/c1-14-7-9-16(10-8-14)13-17-5-3-6-18(25)20(26)28-15(2)19(17)27-12-4-11-21(22,23)24;/h7-10,15,17-19H,3-6,11-13,25H2,1-2H3;1H/t15-,17+,18-,19-;/m0./s1 |
| InChIKey | OJHMTENLHQBQKO-FQQPPKMMSA-N |
| XLogP | 4.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|