C22H30FNO4 — CID 123704153
[8-amino-4-[(4-fluorophenyl)methyl]-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate (PubChem CID 123704153) has the molecular formula C22H30FNO4 and a molecular weight of 391.48 g/mol. Its IUPAC name is [8-amino-4-[(4-fluorophenyl)methyl]-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate.
| Compound Name | [8-amino-4-[(4-fluorophenyl)methyl]-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 123704153 |
| Molecular Formula | C22H30FNO4 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | [8-amino-4-[(4-fluorophenyl)methyl]-2-methyl-9-oxooxonan-3-yl] cyclopentanecarboxylate |
| SMILES | CC1OC(=O)C(N)CCCC(Cc2ccc(F)cc2)C1OC(=O)C1CCCC1 |
| InChI | InChI=1S/C22H30FNO4/c1-14-20(28-21(25)16-5-2-3-6-16)17(7-4-8-19(24)22(26)27-14)13-15-9-11-18(23)12-10-15/h9-12,14,16-17,19-20H,2-8,13,24H2,1H3 |
| InChIKey | WKWLNLIJIPFECK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |