C15H25ClF3NO4 — CID 162304615
(3S,7S,8R,9S)-3-amino-8-cyclopentyloxy-9-methyl-7-(2,2,2-trifluoroethyl)-1,5-dioxonan-2-one;hydrochloride (PubChem CID 162304615) has the molecular formula C15H25ClF3NO4 and a molecular weight of 375.82 g/mol. Its IUPAC name is (3S,7S,8R,9S)-3-amino-8-cyclopentyloxy-9-methyl-7-(2,2,2-trifluoroethyl)-1,5-dioxonan-2-one;hydrochloride.
| Compound Name | (3S,7S,8R,9S)-3-amino-8-cyclopentyloxy-9-methyl-7-(2,2,2-trifluoroethyl)-1,5-dioxonan-2-one;hydrochloride |
|---|---|
| PubChem CID | 162304615 |
| Molecular Formula | C15H25ClF3NO4 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (3S,7S,8R,9S)-3-amino-8-cyclopentyloxy-9-methyl-7-(2,2,2-trifluoroethyl)-1,5-dioxonan-2-one;hydrochloride |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)COC[C@H](CC(F)(F)F)[C@H]1OC1CCCC1.Cl |
| InChI | InChI=1S/C15H24F3NO4.ClH/c1-9-13(23-11-4-2-3-5-11)10(6-15(16,17)18)7-21-8-12(19)14(20)22-9;/h9-13H,2-8,19H2,1H3;1H/t9-,10-,12-,13-;/m0./s1 |
| InChIKey | AKUMVLQRLWUXSD-CSJCYIGJSA-N |
| XLogP | 2.59 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |