C19H33NO4 — CID 123553602
(3S,7S,8S,9S)-3-amino-7,8-dicyclopentyloxy-9-methyloxonan-2-one (PubChem CID 123553602) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3S,7S,8S,9S)-3-amino-7,8-dicyclopentyloxy-9-methyloxonan-2-one.
| Compound Name | (3S,7S,8S,9S)-3-amino-7,8-dicyclopentyloxy-9-methyloxonan-2-one |
|---|---|
| PubChem CID | 123553602 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (3S,7S,8S,9S)-3-amino-7,8-dicyclopentyloxy-9-methyloxonan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)CCC[C@H](OC2CCCC2)[C@H]1OC1CCCC1 |
| InChI | InChI=1S/C19H33NO4/c1-13-18(24-15-9-4-5-10-15)17(23-14-7-2-3-8-14)12-6-11-16(20)19(21)22-13/h13-18H,2-12,20H2,1H3/t13-,16-,17-,18-/m0/s1 |
| InChIKey | NOBZHXXOTIWECU-MGHWNKPDSA-N |
| XLogP | 3.08 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |