C8H14N4O2 — CID 107345192
4-amino-1-(1-methoxypropan-2-yl)pyrazole-3-carboxamide (PubChem CID 107345192) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 4-amino-1-(1-methoxypropan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-(1-methoxypropan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345192 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 4-amino-1-(1-methoxypropan-2-yl)pyrazole-3-carboxamide |
| SMILES | COCC(C)n1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C8H14N4O2/c1-5(4-14-2)12-3-6(9)7(11-12)8(10)13/h3,5H,4,9H2,1-2H3,(H2,10,13) |
| InChIKey | JNJQBIYUEXNUKU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |