C10H18N4O — CID 165471957
4-amino-1-(3-methylpentan-2-yl)pyrazole-3-carboxamide (PubChem CID 165471957) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-amino-1-(3-methylpentan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-(3-methylpentan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 165471957 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-amino-1-(3-methylpentan-2-yl)pyrazole-3-carboxamide |
| SMILES | CCC(C)C(C)n1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C10H18N4O/c1-4-6(2)7(3)14-5-8(11)9(13-14)10(12)15/h5-7H,4,11H2,1-3H3,(H2,12,15) |
| InChIKey | KMTNBPZSOAJXNJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |