C6H10N4O2S — CID 131223531
4-amino-1-ethylsulfinylpyrazole-3-carboxamide (PubChem CID 131223531) has the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. Its IUPAC name is 4-amino-1-ethylsulfinylpyrazole-3-carboxamide.
| Compound Name | 4-amino-1-ethylsulfinylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131223531 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 4-amino-1-ethylsulfinylpyrazole-3-carboxamide |
| SMILES | CCS(=O)n1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C6H10N4O2S/c1-2-13(12)10-3-4(7)5(9-10)6(8)11/h3H,2,7H2,1H3,(H2,8,11) |
| InChIKey | MKODDIFOXBVYGW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |