C8H14N4O — CID 107345234
4-amino-1-butan-2-ylpyrazole-3-carboxamide (PubChem CID 107345234) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 4-amino-1-butan-2-ylpyrazole-3-carboxamide.
| Compound Name | 4-amino-1-butan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345234 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-amino-1-butan-2-ylpyrazole-3-carboxamide |
| SMILES | CCC(C)n1cc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C8H14N4O/c1-3-5(2)12-4-6(9)7(11-12)8(10)13/h4-5H,3,9H2,1-2H3,(H2,10,13) |
| InChIKey | MDPSEJMFHRKSOG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |