C18H32O5 — CID 10735059
(Z)-6-(2-methoxyoxan-2-yl)-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)hex-5-en-3-ol (PubChem CID 10735059) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (Z)-6-(2-methoxyoxan-2-yl)-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)hex-5-en-3-ol.
| Compound Name | (Z)-6-(2-methoxyoxan-2-yl)-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 10735059 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (Z)-6-(2-methoxyoxan-2-yl)-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)hex-5-en-3-ol |
| SMILES | COC1(/C=C\CC(O)CCC2(C)COC(C)(C)O2)CCCCO1 |
| InChI | InChI=1S/C18H32O5/c1-16(2)22-14-17(3,23-16)12-9-15(19)8-7-11-18(20-4)10-5-6-13-21-18/h7,11,15,19H,5-6,8-10,12-14H2,1-4H3/b11-7- |
| InChIKey | DCIPSFAXZOLKEE-XFFZJAGNSA-N |
| XLogP | 3.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|