C9H16N2O3 — CID 107362628
(Z)-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methylpent-2-enamide (PubChem CID 107362628) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (Z)-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methylpent-2-enamide.
| Compound Name | (Z)-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 107362628 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (Z)-N-(3-amino-2-hydroxy-3-oxopropyl)-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C9H16N2O3/c1-3-4-6(2)9(14)11-5-7(12)8(10)13/h4,7,12H,3,5H2,1-2H3,(H2,10,13)(H,11,14)/b6-4- |
| InChIKey | ISBBJBBPEWPROL-XQRVVYSFSA-N |
| XLogP | -0.69 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|