C16H31BrOSi — CID 10736421
[(3S)-3-[(1R)-2-bromo-3-methylcyclopent-2-en-1-yl]butoxy]-tert-butyl-dimethylsilane (PubChem CID 10736421) has the molecular formula C16H31BrOSi and a molecular weight of 347.41 g/mol. Its IUPAC name is [(3S)-3-[(1R)-2-bromo-3-methylcyclopent-2-en-1-yl]butoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3S)-3-[(1R)-2-bromo-3-methylcyclopent-2-en-1-yl]butoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10736421 |
| Molecular Formula | C16H31BrOSi |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(3S)-3-[(1R)-2-bromo-3-methylcyclopent-2-en-1-yl]butoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1=C(Br)[C@@H]([C@@H](C)CCO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31BrOSi/c1-12(14-9-8-13(2)15(14)17)10-11-18-19(6,7)16(3,4)5/h12,14H,8-11H2,1-7H3/t12-,14+/m0/s1 |
| InChIKey | RRTOFEFPTUNZRL-GXTWGEPZSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|