C15H31NO3Si — CID 102319341
(6S)-6-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutyl]piperidin-2-one (PubChem CID 102319341) has the molecular formula C15H31NO3Si and a molecular weight of 301.50 g/mol. Its IUPAC name is (6S)-6-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutyl]piperidin-2-one.
| Compound Name | (6S)-6-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutyl]piperidin-2-one |
|---|---|
| PubChem CID | 102319341 |
| Molecular Formula | C15H31NO3Si |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | (6S)-6-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxybutyl]piperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O)C[C@@H]1CCCC(=O)N1 |
| InChI | InChI=1S/C15H31NO3Si/c1-15(2,3)20(4,5)19-10-9-13(17)11-12-7-6-8-14(18)16-12/h12-13,17H,6-11H2,1-5H3,(H,16,18)/t12-,13+/m0/s1 |
| InChIKey | DLVVWTYVTJAZIT-QWHCGFSZSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|