C16H21BrN2S — CID 107365176
N'-benzyl-N'-[1-(4-bromothiophen-2-yl)ethyl]propane-1,3-diamine (PubChem CID 107365176) has the molecular formula C16H21BrN2S and a molecular weight of 353.33 g/mol. Its IUPAC name is N'-benzyl-N'-[1-(4-bromothiophen-2-yl)ethyl]propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-[1-(4-bromothiophen-2-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 107365176 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N'-benzyl-N'-[1-(4-bromothiophen-2-yl)ethyl]propane-1,3-diamine |
| SMILES | CC(c1cc(Br)cs1)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C16H21BrN2S/c1-13(16-10-15(17)12-20-16)19(9-5-8-18)11-14-6-3-2-4-7-14/h2-4,6-7,10,12-13H,5,8-9,11,18H2,1H3 |
| InChIKey | LVLXVXXUPDSSSX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |