C18H26N2S — CID 107364937
N'-benzyl-N'-(2-methyl-1-thiophen-2-ylpropyl)propane-1,3-diamine (PubChem CID 107364937) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is N'-benzyl-N'-(2-methyl-1-thiophen-2-ylpropyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-methyl-1-thiophen-2-ylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107364937 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N'-benzyl-N'-(2-methyl-1-thiophen-2-ylpropyl)propane-1,3-diamine |
| SMILES | CC(C)C(c1cccs1)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2S/c1-15(2)18(17-10-6-13-21-17)20(12-7-11-19)14-16-8-4-3-5-9-16/h3-6,8-10,13,15,18H,7,11-12,14,19H2,1-2H3 |
| InChIKey | JYVHBHZNTHVWQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |