C15H22N2 — CID 107367944
N'-benzyl-N'-pent-1-yn-3-ylpropane-1,3-diamine (PubChem CID 107367944) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N'-benzyl-N'-pent-1-yn-3-ylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N'-pent-1-yn-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107367944 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N'-benzyl-N'-pent-1-yn-3-ylpropane-1,3-diamine |
| SMILES | C#CC(CC)N(CCCN)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-3-15(4-2)17(12-8-11-16)13-14-9-6-5-7-10-14/h1,5-7,9-10,15H,4,8,11-13,16H2,2H3 |
| InChIKey | XFUIAJAYGCGIEL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|