C14H14N4O7 — CID 10736572
3-[(3-nitrobenzoyl)amino]propyl 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylate (PubChem CID 10736572) has the molecular formula C14H14N4O7 and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-[(3-nitrobenzoyl)amino]propyl 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylate.
| Compound Name | 3-[(3-nitrobenzoyl)amino]propyl 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylate |
|---|---|
| PubChem CID | 10736572 |
| Molecular Formula | C14H14N4O7 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-[(3-nitrobenzoyl)amino]propyl 4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carboxylate |
| SMILES | Cc1c(C(=O)OCCCNC(=O)c2cccc([N+](=O)[O-])c2)no[n+]1[O-] |
| InChI | InChI=1S/C14H14N4O7/c1-9-12(16-25-18(9)23)14(20)24-7-3-6-15-13(19)10-4-2-5-11(8-10)17(21)22/h2,4-5,8H,3,6-7H2,1H3,(H,15,19) |
| InChIKey | DOFIUXUPGXSWRV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|