C22H25NO3 — CID 10736661
(3aS,4S,5S)-4,5-bis(phenylmethoxy)spiro[3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,1'-cyclopropane] (PubChem CID 10736661) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3aS,4S,5S)-4,5-bis(phenylmethoxy)spiro[3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,1'-cyclopropane].
| Compound Name | (3aS,4S,5S)-4,5-bis(phenylmethoxy)spiro[3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,1'-cyclopropane] |
|---|---|
| PubChem CID | 10736661 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3aS,4S,5S)-4,5-bis(phenylmethoxy)spiro[3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,1'-cyclopropane] |
| SMILES | c1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)CN3OC4(CC4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-3-7-17(8-4-1)15-24-20-14-23-19(13-22(26-23)11-12-22)21(20)25-16-18-9-5-2-6-10-18/h1-10,19-21H,11-16H2/t19-,20-,21-/m0/s1 |
| InChIKey | AXUNAICRNFGMEV-ACRUOGEOSA-N |
| XLogP | 3.71 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |