C13H11ClN4O3 — CID 107372032
5-chloro-N-(4,5-dimethyl-2-nitrophenyl)pyrazine-2-carboxamide (PubChem CID 107372032) has the molecular formula C13H11ClN4O3 and a molecular weight of 306.71 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dimethyl-2-nitrophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(4,5-dimethyl-2-nitrophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107372032 |
| Molecular Formula | C13H11ClN4O3 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-chloro-N-(4,5-dimethyl-2-nitrophenyl)pyrazine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnc(Cl)cn2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H11ClN4O3/c1-7-3-9(11(18(20)21)4-8(7)2)17-13(19)10-5-16-12(14)6-15-10/h3-6H,1-2H3,(H,17,19) |
| InChIKey | BAEBPGSBDFKKSX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|