C21H32O4Si — CID 10738321
trans-diethyl (3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 10738321) has the molecular formula C21H32O4Si and a molecular weight of 376.57 g/mol. Its IUPAC name is trans-diethyl (3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10738321 |
| Molecular Formula | C21H32O4Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | trans-diethyl (3S,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](C[Si](C)(C)c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C21H32O4Si/c1-6-24-19(22)21(20(23)25-7-2)13-16(3)17(14-21)15-26(4,5)18-11-9-8-10-12-18/h8-12,16-17H,6-7,13-15H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | ZPQPGQXTQXJPNL-IAGOWNOFSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|